| Name |
Deacetylasperulosidic acid |
| Formula |
C16H22O11 |
| Mw |
390.11621155 |
| CAS RN |
14259-55-3 |
| C_ID |
C00030093
, 
|
| InChIKey |
ZVXWFPTVHBWJOU-NXOHDJQCNA-N |
| InChICode |
InChI=1S/C16H22O11/c17-2-5-1-7(19)10-6(14(23)24)4-25-15(9(5)10)27-16-13(22)12(21)11(20)8(3-18)26-16/h1,4,7-13,15-22H,2-3H2,(H,23,24)/t7-,8-,9-,10+,11+,12+,13-,15+,16+/m1/s1 |
| SMILES |
O=C(O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(CO)=C[C@H](O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliv.  | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
| Plantae | Rubiaceae | Galium rivale | Ref. |
| Plantae | Rubiaceae | Lasianthus acuminatissimus MERR. | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia L.  | Ref. |
| Plantae | Rubiaceae | Saprosma scortechinii | Ref. |
|
|
zoom in
| Organism | Jasminum officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|