| Name |
5-Hydroxypyrrolidin-2-one |
| Formula |
C4H7NO2 |
| Mw |
101.04767848 |
| CAS RN |
62312-55-4 |
| C_ID |
C00029568
, 
|
| InChIKey |
WBGWUCXEMSSZJL-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C4H7NO2/c6-3-1-2-4(7)5-3/h3,6H,1-2H2,(H,5,7)/t3-/m1/s1 |
| SMILES |
O=C1CCC(O)N1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
|
|
zoom in
| Organism | Scrophularia takesimensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|