| Name |
3-Epiursolic acid Morinoursolic acid A |
| Formula |
C30H48O3 |
| Mw |
456.3603454 |
| CAS RN |
989-30-0 |
| C_ID |
C00029496
, 
|
| InChIKey |
WCGUUGGRBIKTOS-PNDZTBPMNA-N |
| InChICode |
InChI=1S/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23-,24+,27+,28-,29-,30+/m1/s1 |
| SMILES |
C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gesneriaceae | Conandron ramondioides Sieb.et Zucc.  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
|
|
zoom in
| Organism | Verbena officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|