| Name |
3-Epioleanolic acid epi-Oleanolic acid |
| Formula |
C30H48O3 |
| Mw |
456.3603454 |
| CAS RN |
25499-90-5 |
| C_ID |
C00029494
, 
|
| InChIKey |
MIJYXULNPSFWEK-XBSYWBQYNA-N |
| InChICode |
InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23+,27-,28+,29+,30-/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gesneriaceae | Conandron ramondioides Sieb.et Zucc.  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Meliaceae | Ekebergia capensis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
|
|
zoom in
| Organism | Salvia officinalis | | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,3,(1992),595B |
|---|
|