| Name |
Zhebeinone |
| Formula |
C27H43NO3 |
| Mw |
429.32429425 |
| CAS RN |
144606-87-1 |
| C_ID |
C00029264
, 
|
| InChIKey |
IQDIERHFZVCNRZ-FEMXLRPTNA-N |
| InChICode |
InChI=1S/C27H43NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-23,25,29,31H,4-14H2,1-3H3/t15-,16+,17-,18-,19+,20+,21+,22+,23-,25+,26-,27+/m1/s1 |
| SMILES |
C[C@@H]1CC[C@@H]2N(C1)C[C@H]1[C@@H]3C[C@H]4[C@@H](CC(=O)[C@H]5C[C@@H](O)CC[C@@]54C)[C@@H]3CC[C@@H]1[C@]2(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Liliaceae | Fritillaria thunbergii  | Ref. |
| Plantae | Liliaceae | Fritillaria verticillata var.thunbergii  | Ref. |
|
|
zoom in
| Organism | Fritillaria verticillata var.thunbergii | | Reference | Zhang, et al., APS, 27, (1992), 472.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|