| Name |
Tomatidenol |
| Formula |
C27H43NO2 |
| Mw |
413.32937962 |
| CAS RN |
546-40-7 |
| C_ID |
C00029137
, 
|
| InChIKey |
KWVISVAMQJWJSZ-QBNTYWKXNA-N |
| InChICode |
InChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17-,19-,20+,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| SMILES |
C[C@H]1CC[C@]2(NC1)O[C@H]1C[C@H]3C4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Liliaceae | Fritillaria camtschatcensis | Ref. |
| Plantae | Solanaceae | Solanum dulcamara  | Ref. |
| Plantae | Solanaceae | Solanum havanense | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Solanum dulcamara | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|