| Name |
Tatsiensine |
| Formula |
C27H39NO7 |
| Mw |
489.27265261 |
| CAS RN |
86695-18-3 |
| C_ID |
C00029075
, 
|
| InChIKey |
AARMMVPNMUKXKI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C27H39NO7/c1-7-28-12-24(3)9-8-18(31-5)26-16-10-15-17(30-4)11-25(19(16)20(15)32-6)27(23(26)28,34-13-33-25)22(21(24)26)35-14(2)29/h8-9,15-23H,7,10-13H2,1-6H3/t15-,16-,17-,18+,19-,20+,21+,22+,23-,24-,25-,26-,27+/m0/s1 |
| SMILES |
CCN1CC2(C)C=CC(OC)C34C5CC6C(OC)CC7(OCOC7(C(OC(C)=O)C23)C14)C5C6OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Delphinium giraldii | Ref. |
| Plantae | Ranunculaceae | Delphinium kamaonense var.glabrescens  | Ref. |
| Plantae | Ranunculaceae | Delphinium majus | Ref. |
| Plantae | Ranunculaceae | Delphinium siwanense var. leptogen | Ref. |
| Plantae | Ranunculaceae | Delphinium tatsienense | Ref. |
| Plantae | Ranunculaceae | Delphinium tatsiense | Ref. |
|
|
zoom in
| Organism | Delphinium kamaonense var.glabrescens | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., NPRD, 15, (2003), 498 |
|---|
|