| Name |
N-Isobutyldeca-trans-2-trans-4-dienamide Pellitorine |
| Formula |
C14H25NO |
| Mw |
223.19361443 |
| CAS RN |
18836-52-7 |
| C_ID |
C00028813
, 
|
| InChIKey |
QMIWSRNEYNUYFE-HULFFUFUNA-N |
| InChICode |
InChI=1S/C14H25NO/c1-4-6-7-8-9-10-11-12-14(16)15-13(3)5-2/h9-13H,4-8H2,1-3H3,(H,15,16)/b10-9+,12-11+/t13-/m1/s1 |
| SMILES |
CCCCC/C=C/C=C/C(=O)NC(C)CC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia dracunculus  | Ref. |
| Plantae | Piperaceae | Piper kadsura  | Ref. |
| Plantae | Piperaceae | Piper longum  | Ref. |
| Plantae | Piperaceae | Piper nigrum L.  | Ref. |
| Plantae | Piperaceae | Piper pedicellosum | Ref. |
| Plantae | Piperaceae | Piper retrofractum  | Ref. |
| Plantae | Piperaceae | Piper sarmentosum  | Ref. |
| Plantae | Piperaceae | Piper tuberculatum  | Ref. |
| Plantae | Piperaceae | Piper tuberculatum Jacq.  | Ref. |
| Plantae | Rutaceae | Fagara xanthoxyloides | Ref. |
| Plantae | Rutaceae | Stauranthus perforatus | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
|
|
zoom in
| Organism | Piper kadsura | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Konishi, et al., Chem Pharm Bull, 53, (2005), 121.
Wei, et al., Journal of Natural Products, 67, (2004), 1005.
Anaya, et al., Phytochemistry, 66, (2005), 487.
Chaaib, et al., Planta Med, 69, (2003), 316 |
|---|
|