| Name |
Papraine |
| Formula |
C19H17NO6 |
| Mw |
355.10558728 |
| CAS RN |
125263-86-7 |
| C_ID |
C00028800
, 
|
| InChIKey |
XPVUPHZUUXVXQD-LQKAMQBPNA-N |
| InChICode |
InChI=1S/C19H17NO6/c1-20-5-4-9-6-12(21)13(22)7-11(9)16(20)17-10-2-3-14-18(25-8-24-14)15(10)19(23)26-17/h2-3,6-7,16-17,21-22H,4-5,8H2,1H3/t16-,17+/m0/s1 |
| SMILES |
CN1CCc2cc(O)c(O)cc2[C@H]1[C@@H]1OC(=O)c2c1ccc1c2OCO1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
|
|
zoom in
| Organism | Fumaria kralikii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|