| Name |
Isoconessimine Norconessine |
| Formula |
C23H38N2 |
| Mw |
342.30349923 |
| CAS RN |
468-36-0 |
| C_ID |
C00028718
, 
|
| InChIKey |
UBWOPONWVXRTKE-VVJRUZARNA-N |
| InChICode |
InChI=1S/C23H38N2/c1-15-19-7-8-21-18-6-5-16-13-17(24-3)9-11-22(16,2)20(18)10-12-23(19,21)14-25(15)4/h5,15,17-21,24H,6-14H2,1-4H3/t15-,17-,18+,19+,20-,21-,22-,23-/m0/s1 |
| SMILES |
CN[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]5[C@H](C)N(C)C[C@@]54CC[C@@H]32)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Holarrhena antidysenterica  | Ref. |
| Plantae | Apocynaceae | Holarrhena febrifuga | Ref. |
| Plantae | Apocynaceae | Holarrhena pubescens Buch.Ham  | Ref. |
| Plantae | Apocynaceae | Wrightia tomentosa  | Ref. |
|
|
zoom in
| Organism | Holarrhena febrifuga | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|