| Name |
Lycophlegmarine |
| Formula |
C18H27NO3 |
| Mw |
305.19909374 |
| CAS RN |
80953-35-1 |
| C_ID |
C00028515
, 
|
| InChIKey |
QVPREBHRCCEOMO-KGXJJPPQNA-N |
| InChICode |
InChI=1S/C18H27NO3/c1-12-10-13-11-15(20)14-6-4-8-19(2)9-5-7-18(13,14)17(21)16(12)22-3/h6,13,15,20H,4-5,7-11H2,1-3H3/b14-6-/t13-,15-,18-/m0/s1 |
| SMILES |
COC1=C(C)C[C@H]2CC(O)/C3=C/CCN(C)CCC[C@@]32C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Lycopodium phlegmaria | Ref. |
| Plantae | Lycopodiaceae | Phlegmariurus phlegmaria | Ref. |
|
|
zoom in
| Organism | Phlegmariurus phlegmaria | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|