| Name |
Leonticine |
| Formula |
C20H25NO3 |
| Mw |
327.18344367 |
| CAS RN |
2609-29-2 |
| C_ID |
C00028456
, 
|
| InChIKey |
GVZVHYFESLXAML-YRNVUSSQSA-N |
| InChICode |
InChI=1S/C20H25NO3/c1-21(2)14-13-16-8-12-19(24-4)20(22)18(16)11-7-15-5-9-17(23-3)10-6-15/h5-12,22H,13-14H2,1-4H3/b11-7+ |
| SMILES |
COc1ccc(/C=C/c2c(CCN(C)C)ccc(OC)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Leontice leontopetalum  | Ref. |
| Plantae | Fumariaceae | Corydalis clavicaulata | Ref. |
| Plantae | Fumariaceae | Corydalis claviculata | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo | Ref. |
|
|
zoom in
| Organism | Corydalis clavicaulata |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
