| Name |
Laudanine dl-Laudanidine |
| Formula |
C20H25NO4 |
| Mw |
343.17835829 |
| CAS RN |
85-64-3 |
| C_ID |
C00028453
, 
|
| InChIKey |
MPYHGNAJOKCMAQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H25NO4/c1-21-8-7-14-11-19(24-3)20(25-4)12-15(14)16(21)9-13-5-6-18(23-2)17(22)10-13/h5-6,10-12,16,22H,7-9H2,1-4H3/t16-/m0/s1 |
| SMILES |
COc1ccc(CC2c3cc(OC)c(OC)cc3CCN2C)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Ocotea insularis | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum dasycarpum | Ref. |
|
|
zoom in
| Organism | Papaver somniferum | | Reference | Schmidt,Phytochem.,68,(2007),189
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|