| Name |
Fumariflorine |
| Formula |
C12H15NO4 |
| Mw |
237.10010798 |
| CAS RN |
76948-81-7 |
| C_ID |
C00028282
, 
|
| InChIKey |
BOZYJTCKDCTZDN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H15NO4/c1-13(2)4-3-8-5-10-11(17-7-16-10)6-9(8)12(14)15/h5-6H,3-4,7H2,1-2H3,(H,14,15) |
| SMILES |
CN(C)CCc1cc2c(cc1C(=O)O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora Lam.  | Ref. |
|
|
zoom in
| Organism | Fumaria kralikii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|