| Name |
Domesticine (+)-Domesticine |
| Formula |
C19H19NO4 |
| Mw |
325.1314081 |
| CAS RN |
476-71-1 |
| C_ID |
C00028217
, 
|
| InChIKey |
ZMNSHBTYBQNBPV-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C19H19NO4/c1-20-4-3-10-6-16(22-2)19(21)18-12-8-15-14(23-9-24-15)7-11(12)5-13(20)17(10)18/h6-8,13,21H,3-5,9H2,1-2H3/t13-/m0/s1 |
| SMILES |
COc1cc2c3c(c1O)-c1cc4c(cc1C[C@@H]3N(C)CC2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
| Plantae | Fumariaceae | Fumaria agraria | Ref. |
| Plantae | Fumariaceae | Platycapnos spicata | Ref. |
|
|
zoom in
| Organism | Fumaria agraria | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|