| Name |
Litcubinine (-)-Litcubinine |
| Formula |
C18H20NO4 |
| Mw |
314.13923313 |
| CAS RN |
172924-24-2 |
| C_ID |
C00027560
, 
|
| InChIKey |
HVZWFRMKXRRMBK-UHFFFAOYNA-O |
| InChICode |
InChI=1S/C18H19NO4/c1-19-4-3-10-7-18(23-2)17(22)8-12(10)14(19)5-11-6-15(20)16(21)9-13(11)19/h6-9,14H,3-5H2,1-2H3,(H2-,20,21,22)/p+1/t14-,19-/m1/s1 |
| SMILES |
COc1cc2c(cc1O)C1Cc3cc(O)c(O)cc3[N+]1(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Menispermaceae | Tinospora crispa  | Ref. |
| - | - | Lisea cubeba | Ref. |
|
|
zoom in
| Organism | Tinospora crispa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|