| Name |
Norjuziphine
(-)-Norjusiphine
(-)-Norjuziphine
Noryuziphine |
| Formula |
C17H19NO3 |
| Mw |
285.13649348 |
| CAS RN |
74119-87-2 |
| C_ID |
C00027440
, 
|
| InChIKey |
BXWMZVREXWPYKF-YQTOOIBONA-N |
| InChICode |
InChI=1S/C17H19NO3/c1-21-15-7-4-12-8-9-18-14(16(12)17(15)20)10-11-2-5-13(19)6-3-11/h2-7,14,18-20H,8-10H2,1H3/t14-/m1/s1 |
| SMILES |
COc1ccc2c(c1O)[C@@H](Cc1ccc(O)cc1)NCC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Porcelia macrocarpa | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii Loisl. | Ref. |
| Plantae | Lauraceae | Litsea acuminata | Ref. |
| Plantae | Lauraceae | Nectandra salicifolia | Ref. |
| Plantae | Lauraceae | Neolitsea villosa | Ref. |
| Plantae | Lauraceae | Phoebe formosana | Ref. |
| Plantae | Lauraceae | Phoebe minutiflora | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
