| Name |
10H-quindoline Quindoline |
| Formula |
C15H10N2 |
| Mw |
218.08439833 |
| CAS RN |
243-58-3 |
| C_ID |
C00026582
, 
|
| InChIKey |
QOAKRWLMTKEDDL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10N2/c1-3-7-12-10(5-1)9-14-15(17-12)11-6-2-4-8-13(11)16-14/h1-9,16H |
| SMILES |
c1ccc2nc3c(cc2c1)[nH]c1ccccc13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Justicia betonica  | Ref. |
| Plantae | Malvaceae | Sida rhombifolia  | Ref. |
|
|
zoom in
| Organism | Sida rhombifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|