| Name |
Alborine |
| Formula |
C22H22NO6 |
| Mw |
396.14471244 |
| CAS RN |
23943-91-1 |
| C_ID |
C00026109
, 
|
| InChIKey |
YBDPGYNCDXZFOS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H22NO6/c1-25-17-7-13-9-23-5-4-12-6-18-21(29-11-28-18)22(27-3)19(12)16(23)8-14(13)15(10-24)20(17)26-2/h6-9,24H,4-5,10-11H2,1-3H3/q+1 |
| SMILES |
COc1cc2c[n+]3c(cc2c(CO)c1OC)-c1c(cc2c(c1OC)OCO2)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver alboroseum | Ref. |
| Plantae | Papaveraceae | Papaver kerneri | Ref. |
| Plantae | Papaveraceae | Papaver orientale  | Ref. |
| Plantae | Papaveraceae | Papaver pseudoorientale (Fedde) Medw. | Ref. |
|
|
zoom in
| Organism | Papaver kerneri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|