| Name |
l-Sinactine (-)-Sinactine |
| Formula |
C20H21NO4 |
| Mw |
339.14705817 |
| CAS RN |
22554-51-4 |
| C_ID |
C00026093
, 
|
| InChIKey |
UWEHVAXMSWXKRW-XISACWJONA-N |
| InChICode |
InChI=1S/C20H21NO4/c1-22-18-8-13-5-6-21-10-15-12(3-4-17-20(15)25-11-24-17)7-16(21)14(13)9-19(18)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3/t16-/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)[C@@H]1Cc3ccc4c(c3CN1CC2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria cilicica | Ref. |
| Plantae | Fumariaceae | Fumaria macrocarpa | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis L.  | Ref. |
| Plantae | Fumariaceae | Fumaria petteri | Ref. |
| Plantae | Rutaceae | Fagara officinalis | Ref. |
|
|
zoom in
| Organism | Fumaria macrocarpa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|