| Name |
Cheilanthifoline (-)-Cheilanthifoline (S)-Cheilanthifoline |
| Formula |
C19H19NO4 |
| Mw |
325.1314081 |
| CAS RN |
483-44-3 |
| C_ID |
C00026087
, 
|
| InChIKey |
MKRKFSHHTKVRAR-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C19H19NO4/c1-22-18-8-13-12(7-16(18)21)4-5-20-9-14-11(6-15(13)20)2-3-17-19(14)24-10-23-17/h2-3,7-8,15,21H,4-6,9-10H2,1H3/t15-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)CCN1Cc3c(ccc4c3OCO4)C[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis bulleyana | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis caucasia | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis claviculata | Ref. |
| Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey. | Ref. |
| Plantae | Fumariaceae | Corydalis hsuchowensis | Ref. |
| Plantae | Fumariaceae | Corydalis majori | Ref. |
| Plantae | Fumariaceae | Corydalis ophiocarpa Thoms | Ref. |
| Plantae | Fumariaceae | Corydalis stewartii | Ref. |
| Plantae | Fumariaceae | Dactylicapnos torulosa | Ref. |
| Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
| Plantae | Fumariaceae | Fumaria bella | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria judaica Boiss | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora Lam.  | Ref. |
| Plantae | Menispermaceae | Menispermum dauricum DC.  | Ref. |
| Plantae | Papaveraceae | Argemone mexicana  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Papaveraceae | Chelidonium meifolia Wall. | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
| Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
| Plantae | Papaveraceae | Papaver macrostomum Boiss.et Huet | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas  | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Papaveraceae | Papaver trinifolium | Ref. |
| Plantae | Papaveraceae | Papaver triniifolium | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| - | - | Fumaris vaillantii Loisel. | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|