| Name |
Protostephanine |
| Formula |
C21H27NO4 |
| Mw |
357.19400836 |
| CAS RN |
549-28-0 |
| C_ID |
C00026018
, 
|
| InChIKey |
GMRPVRSCPJYUDP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H27NO4/c1-22-8-6-14-10-20(25-4)21(26-5)13-17(14)18-11-15(23-2)12-19(24-3)16(18)7-9-22/h10-13H,6-9H2,1-5H3 |
| SMILES |
COc1cc(OC)c2c(c1)-c1cc(OC)c(OC)cc1CCN(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Hyperbaena columbica (Eichl.) Miers | Ref. |
| Plantae | Menispermaceae | Stephania corymbosa BL. | Ref. |
| Plantae | Menispermaceae | Stephania japonica (Thumb.) Miers var.australis  | Ref. |
| Plantae | Stemonaceae | Stemona japonica Miq.  | Ref. |
|
|
zoom in
| Organism | Stephania corymbosa BL. | | Reference | Gustini,Alkaloid of stephania corymbosa BL.Thesis of Post Graduate Student,Inst.Techn.Banduang, Indonesia,(1989) |
|---|
|