| Name |
Menisarine (+)-Menisarine |
| Formula |
C36H34N2O6 |
| Mw |
590.24168683 |
| CAS RN |
6415-97-0 |
| C_ID |
C00025938
, 
|
| InChIKey |
NFJBFDIGRHLZNO-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C36H34N2O6/c1-38-14-12-23-19-30(41-4)34-36-32(23)26(38)16-21-7-10-27(39-2)28(17-21)42-24-8-5-20(6-9-24)15-25-31-22(11-13-37-25)18-29(40-3)33(44-36)35(31)43-34/h5-10,17-19,26H,11-16H2,1-4H3/t26-/m1/s1 |
| SMILES |
COc1ccc2cc1Oc1ccc(cc1)CC1=NCCc3cc(OC)c4c(c31)Oc1c(OC)cc3c(c1O4)C(C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Cocculus pendulus (Forsk.) Diels  | Ref. |
| Plantae | Menispermaceae | Cocculus trilobus  | Ref. |
|
|
zoom in
| Organism | Cocculus trilobus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|