| Name |
Lindoldhamine (+)-Lindoldhamine |
| Formula |
C34H36N2O6 |
| Mw |
568.2573369 |
| CAS RN |
60342-37-2 |
| C_ID |
C00025930
, 
|
| InChIKey |
DUBVXSGAOWUPMY-LEFKRGDZNA-N |
| InChICode |
InChI=1S/C34H36N2O6/c1-40-32-16-22-9-11-35-27(25(22)18-30(32)38)13-20-3-6-24(7-4-20)42-34-15-21(5-8-29(34)37)14-28-26-19-31(39)33(41-2)17-23(26)10-12-36-28/h3-8,15-19,27-28,35-39H,9-14H2,1-2H3/t27-,28-/m1/s1 |
| SMILES |
COc1cc2c(cc1O)[C@@H](Cc1ccc(Oc3cc(C[C@H]4NCCc5cc(OC)c(O)cc54)ccc3O)cc1)NCC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
| Plantae | Lauraceae | Lindera oldhami | Ref. |
| Plantae | Menispermaceae | Albertisia papuana Becc. | Ref. |
|
|
zoom in
| Organism | Lindera megaphylla | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|