| Name |
Isovallesiachotamine (Z)-Vallesiachotamine 17-Isovallesiachotamine |
| Formula |
C21H22N2O3 |
| Mw |
350.16304258 |
| CAS RN |
34384-71-9 |
| C_ID |
C00025915
, 
|
| InChIKey |
NTVLUSJWJRSPSM-GNOSRRHSNA-N |
| InChICode |
InChI=1S/C21H22N2O3/c1-3-13(12-24)16-10-19-20-15(14-6-4-5-7-18(14)22-20)8-9-23(19)11-17(16)21(25)26-2/h3-7,11-12,16,19,22H,8-10H2,1-2H3/b13-3+/t16-,19-/m0/s1 |
| SMILES |
C/C=C(C=O)[C@@H]1C[C@H]2c3[nH]c4ccccc4c3CCN2C=C1C(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
| Plantae | Apocynaceae | Tabernaemontana psorocarpa (Pierre ex Stapf) Pichon | Ref. |
| Plantae | Rubiaceae | Chimarrhis turbinata | Ref. |
| Plantae | Rubiaceae | Psychotria bahiensis | Ref. |
|
|
zoom in
| Organism | Rauwolfia verticillata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|