| Name |
(-)-Dicentrine (R)-(-)-Dicentrine L-Dicentrine NSC 251699 |
| Formula |
C20H21NO4 |
| Mw |
339.14705817 |
| CAS RN |
28832-07-7 |
| C_ID |
C00025607
, 
|
| InChIKey |
YJWBWQWUHVXPNC-YQTOOIBONA-N |
| InChICode |
InChI=1S/C20H21NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)-c1c3c(cc4c1[C@@H](C2)N(C)CC4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Dicentra pusilla | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Menispermaceae | Stephania brachyandra Diels | Ref. |
| Plantae | Menispermaceae | Stephania delavayi Diels | Ref. |
| Plantae | Menispermaceae | Stephania dicentrinifera H.S.Lo.et.M.Yang | Ref. |
| Plantae | Menispermaceae | Stephania epigaea H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania kuinanensis H.S.Lo & M.Yang | Ref. |
| Plantae | Menispermaceae | Stephania mashanica H.S.Lo.et.B.N.Chang | Ref. |
| Plantae | Menispermaceae | Stephania pierrei Diels  | Ref. |
|
|
zoom in
| Organism | Cassytha filiformis | | Reference | Hoet, et al., Planta Med, 70, (2004), 407.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|