| Name |
Lycophlegmine |
| Formula |
C16H23NO2 |
| Mw |
261.17287899 |
| CAS RN |
82841-97-2 |
| C_ID |
C00025392
, 
|
| InChIKey |
SRCDVLQWMPMBLH-RBBCULIUNA-N |
| InChICode |
InChI=1S/C16H23NO2/c1-10-5-11-6-15(19)13-3-2-4-17-9-12(18)7-14(11)16(13,17)8-10/h7,10-13,18H,2-6,8-9H2,1H3/t10-,11+,12+,13-,16+/m1/s1 |
| SMILES |
C[C@@H]1C[C@H]2CC(=O)[C@H]3CCCN4C[C@@H](O)C=C2[C@]34C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Lycopodium phlegmaria L. | Ref. |
| Plantae | Lycopodiaceae | Phlegmariurus phlegmaria | Ref. |
|
|
zoom in
| Organism | Phlegmariurus phlegmaria | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|