| Name |
Stephabine |
| Formula |
C21H22NO5 |
| Mw |
368.14979782 |
| CAS RN |
109028-32-2 |
| C_ID |
C00025343
, 
|
| InChIKey |
IEQMVBMZEXXFIL-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C21H21NO5/c1-24-16-9-13-7-15-19-12(8-18(26-3)21(27-4)20(19)23)5-6-22(15)11-14(13)10-17(16)25-2/h7-11H,5-6H2,1-4H3/p+1 |
| SMILES |
COc1cc2cc3[n+](cc2cc1OC)CCc1cc(OC)c(OC)c(O)c1-3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Stephania suberosa Forman | Ref. |
| Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
|
|
zoom in
| Organism | Coptis chinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|