| Name |
Lepedine |
| Formula |
C23H35NO3 |
| Mw |
373.26169399 |
| CAS RN |
111509-09-2 |
| C_ID |
C00024924
, 
|
| InChIKey |
XXZZJNAAUWXZNM-NVDRTERZNA-N |
| InChICode |
InChI=1S/C23H35NO3/c1-5-24-11-21(3)8-7-16(27-4)23-15(21)10-14(19(23)24)22-9-6-13(12(2)20(22)26)17(25)18(22)23/h13-20,25-26H,2,5-11H2,1,3-4H3/t13-,14+,15-,16+,17+,18-,19-,20-,21+,22+,23-/m1/s1 |
| SMILES |
C=C1[C@H]2CC[C@]3([C@@H]1O)[C@H]1C[C@@H]4C5(C)CC[C@H](OC)C4([C@@H]1N(CC)C5)[C@@H]3[C@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum pseudohuilense | Ref. |
| Plantae | Ranunculaceae | Aconitum pseudohuiliense | Ref. |
|
|
zoom in
| Organism | Aconitum pseudohuiliense | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|