| Name |
Isoarnottianamide |
| Formula |
C21H19NO6 |
| Mw |
381.12123735 |
| CAS RN |
60394-91-4 |
| C_ID |
C00024651
, 
|
| InChIKey |
VAAALYZSWYRNHB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H19NO6/c1-22(10-23)21-13(15-8-17(25-2)18(26-3)9-16(15)24)5-4-12-6-19-20(7-14(12)21)28-11-27-19/h4-10,24H,11H2,1-3H3 |
| SMILES |
COc1cc(O)c(-c2ccc3cc4c(cc3c2N(C)C=O)OCO4)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Zanthoxylum cuspidatum Champ. | Ref. |
| Plantae | Rutaceae | Zanthoxylum nitidum  | Ref. |
|
|
zoom in
| Organism | Zanthoxylum nitidum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
