| Name |
(+)-Corynoline Corynoline |
| Formula |
C21H21NO5 |
| Mw |
367.14197279 |
| CAS RN |
18797-79-0 |
| C_ID |
C00024624
, 
|
| InChIKey |
IQUGPRHKZNCHGC-WZZMAUMANA-N |
| InChICode |
InChI=1S/C21H21NO5/c1-21-14-3-4-15-19(27-10-24-15)13(14)8-22(2)20(21)12-7-17-16(25-9-26-17)5-11(12)6-18(21)23/h3-5,7,18,20,23H,6,8-10H2,1-2H3/t18-,20+,21-/m0/s1 |
| SMILES |
CN1Cc2c(ccc3c2OCO3)[C@@]2(C)[C@@H](O)Cc3cc4c(cc3[C@@H]12)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis bulleyana | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis conspersa | Ref. |
| Plantae | Fumariaceae | Corydalis incisa (Thumb.)Pers. | Ref. |
| Plantae | Fumariaceae | Corydalis lineariodes | Ref. |
| Plantae | Fumariaceae | Corydalis melanochlora | Ref. |
| Plantae | Fumariaceae | Corydalis mucronifera | Ref. |
| Plantae | Fumariaceae | Corydalis stricta Steph. | Ref. |
| Plantae | Fumariaceae | Corydalis trachycarpa | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|