| Name |
(-)-Aspidospermine Aspidospermine |
| Formula |
C22H30N2O2 |
| Mw |
354.23072822 |
| CAS RN |
466-49-9 |
| C_ID |
C00024452
, 
|
| InChIKey |
ARQOGCYMPUOVHK-FODZYLKCNA-N |
| InChICode |
InChI=1S/C22H30N2O2/c1-4-21-10-6-13-23-14-12-22(20(21)23)16-7-5-8-17(26-3)19(16)24(15(2)25)18(22)9-11-21/h5,7-8,18,20H,4,6,9-14H2,1-3H3/t18-,20-,21-,22-/m1/s1 |
| SMILES |
CC[C@@]12CCCN3CC[C@]4(c5cccc(OC)c5N(C(C)=O)[C@@H]4CC1)[C@H]32 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Aspidosperma pyrifolium | Ref. |
| Plantae | Apocynaceae | Aspidosperma quebracho-blanco  | Ref. |
| Plantae | Apocynaceae | Aspidosperma rhombeosignatum | Ref. |
| Plantae | Apocynaceae | Geissospermum argenteum  | Ref. |
| Plantae | Apocynaceae | Strempeliopsis strempelioides | Ref. |
| Plantae | Apocynaceae | Vallesia glabra  | Ref. |
|
|
zoom in
| Organism | Aspidosperma quebracho-blanco | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
|---|
|