| Name |
8-O-(p-Coumaroyl)-harpagide 8-O-(p-Coumaroyl)harpagide |
| Formula |
C24H30O12 |
| Mw |
510.17372642 |
| CAS RN |
87686-74-6 |
| C_ID |
C00024025
, 
|
| InChIKey |
AZKQDXZMKREFDY-YWTGKOCINA-N |
| InChICode |
InChI=1S/C24H30O12/c1-23(36-16(28)7-4-12-2-5-13(26)6-3-12)10-15(27)24(32)8-9-33-22(20(23)24)35-21-19(31)18(30)17(29)14(11-25)34-21/h2-9,14-15,17-22,25-27,29-32H,10-11H2,1H3/b7-4+/t14-,15-,17-,18+,19+,20-,21+,22+,23+,24+/m1/s1 |
| SMILES |
C[C@]1(OC(=O)/C=C/c2ccc(O)cc2)C[C@@H](O)[C@]2(O)C=CO[C@@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pedaliaceae | Harpagophytum procumbens DC  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|