| Name |
Stigmasta-5,7-dien-3beta-ol (24S)24-Ethylcholesta-5,7-dien-3beta-ol |
| Formula |
C29H48O |
| Mw |
412.37051615 |
| CAS RN |
521-04-0 |
| C_ID |
C00023772
, 
|
| InChIKey |
ARVGMISWLZPBCH-FARKGMMWNA-N |
| InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10-11,19-21,23,25-27,30H,7-9,12-18H2,1-6H3/t20-,21-,23+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Cronartiaceae | Cronartium fusiforme | Ref. |
| Fungi | Melampsoraceae | Melampsora lini | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
|
|
zoom in
| Organism | Melampsora lini | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function of Sterols in Fungi,Advances in Lipid Rese |
|---|
|