| Name |
Encecalinol 6-(1-Hydroxyethyl)-7-methoxy-2,2-dimethylchromene |
| Formula |
C14H18O3 |
| Mw |
234.12559444 |
| CAS RN |
62458-62-2 |
| C_ID |
C00023228
, 
|
| InChIKey |
ZMQPULSGBXIVGC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C14H18O3/c1-9(15)11-7-10-5-6-14(2,3)17-12(10)8-13(11)16-4/h5-9,15H,1-4H3/t9-/m0/s1 |
| SMILES |
COc1cc2c(cc1C(C)O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratina pichinchensis var. bustamenta | Ref. |
| Plantae | Asteraceae | Hemizonia fitchii | Ref. |
|
|
zoom in
| Organism | Ageratina pichinchensis var. bustamenta | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|