| Name |
Sobrerol |
| Formula |
C10H18O2 |
| Mw |
170.13067982 |
| CAS RN |
498-71-5 |
| C_ID |
C00022009
, 
|
| InChIKey |
OMDMTHRBGUBUCO-MDWBIBFBNA-N |
| InChICode |
InChI=1S/C10H18O2/c1-7-4-5-8(6-9(7)11)10(2,3)12/h4,8-9,11-12H,5-6H2,1-3H3/t8-,9-/m0/s1 |
| SMILES |
CC1=CC[C@H](C(C)(C)O)C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Cyperus longus  | Ref. |
| - | - | occurs in many plants(vegetables and fruits) | Ref. |
|
|
zoom in
| Organism | occurs in many plants(vegetables and fruits) |
|---|
| Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Lu, et al., CTHD, 33, (2002), 563 |
|---|
|
