| Name |
beta-Patchoulene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
514-51-2 |
| C_ID |
C00021290
, 
|
| InChIKey |
CSKINCSXMLCMAR-BLZSYCDFNA-N |
| InChICode |
InChI=1S/C15H24/c1-10-5-6-13-12(10)9-11-7-8-15(13,4)14(11,2)3/h10-11H,5-9H2,1-4H3/t10-,11+,15-/m0/s1 |
| SMILES |
C[C@H]1CCC2=C1C[C@H]1CC[C@]2(C)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamsi | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana wallichii  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zygophyllaceae | Bulnesia sarmienti | Ref. |
|
|
zoom in
| Organism | Thymus broussonetti | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|