| Name |
Cucumadiol Curcumadiol |
| Formula |
C15H26O2 |
| Mw |
238.19328007 |
| CAS RN |
31946-48-2 |
| C_ID |
C00020412
, 
|
| InChIKey |
FNMDHMSGEIODFP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H26O2/c1-10(2)11-5-7-14(3,16)12-6-8-15(4,17)13(12)9-11/h5,10,12-13,16-17H,6-9H2,1-4H3/t12-,13-,14+,15-/m0/s1 |
| SMILES |
CC(C)C1=CCC(C)(O)C2CCC(C)(O)C2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber mioga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|