| Name |
Haginin E 7,4'-Dihydroxyisoflav-3-ene Dehydroequol Phenoxodiol NV 06 |
| Formula |
C15H12O3 |
| Mw |
240.07864425 |
| CAS RN |
81267-65-4 |
| C_ID |
C00018937
, 
|
| InChIKey |
ZZUBHVMHNVYXRR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H12O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-8,16-17H,9H2 |
| SMILES |
Oc1ccc(C2=Cc3ccc(O)cc3OC2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lespedeza homoloba | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|