| Name |
Trypacidin |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
1900-29-4 |
| C_ID |
C00018709
, 
|
| InChIKey |
KMZYINVXZDQCKC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H16O7/c1-9-5-12(22-2)15-13(6-9)25-18(16(15)20)11(17(21)24-4)7-10(19)8-14(18)23-3/h5-8H,1-4H3/t18-/m1/s1 |
| SMILES |
COC(=O)C1=CC(=O)C=C(OC)C12Oc1cc(C)cc(OC)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Plantae | Polygonaceae | Rumex dentatus  | Ref. |
| Plantae | Polygonaceae | Rumex vesicarius  | Ref. |
|
|
zoom in
| Organism | Rumex dentatus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|