| Name |
Radulanin A |
| Formula |
C19H20O2 |
| Mw |
280.14632988 |
| CAS RN |
68104-12-1 |
| C_ID |
C00015852
, 
|
| InChIKey |
GYPPDNDDXCBVDJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H20O2/c1-14-7-10-17-18(20)11-16(12-19(17)21-13-14)9-8-15-5-3-2-4-6-15/h2-7,11-12,20H,8-10,13H2,1H3 |
| SMILES |
CC1=CCc2c(O)cc(CCc3ccccc3)cc2OC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| - | - | Radula buccinifera | Ref. |
| - | - | Radula complanata | Ref. |
| - | - | Radula javanica | Ref. |
| - | - | Radula voluta | Ref. |
|
|
zoom in
| Organism | Radula complanata | | Reference | Asakawa,Phytochem.,30,(1991),235
Asakawa,Chemical constituents of Hepaticae, in Progress in the Chemistry of Organic Natural Products,Springer,Vienna,(1982),1 |
|---|
|