| Name |
Perrottetin F
Perrottetine F |
| Formula |
C28H26O5 |
| Mw |
442.17802394 |
| CAS RN |
89911-98-8 |
| C_ID |
C00015845
, 
|
| InChIKey |
QFNWXQOYUAXUAF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C28H26O5/c29-23-5-1-3-20(15-23)8-7-19-11-13-25(14-12-19)33-27-18-22(17-26(31)28(27)32)10-9-21-4-2-6-24(30)16-21/h1-6,11-18,29-32H,7-10H2 |
| SMILES |
Oc1cccc(CCc2ccc(Oc3cc(CCc4cccc(O)c4)cc(O)c3O)cc2)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Jubulaceae | Frullania convoluta | Ref. |
| Plantae | Ophioglossaceae | Lunularia cruciata | Ref. |
| - | - | Radula kojana | Ref. |
| - | - | Radula perrottetii | Ref. |
|
|
zoom in
| Organism | Lunularia cruciata |
|---|
| Reference | Hashimoto,8th Symposium on the Development and Application of Naturally Occurring Drug Materials,(1991),21 |
|---|
|
