| Name |
Miyabenol A |
| Formula |
C56H42O12 |
| Mw |
906.26762681 |
| CAS RN |
109617-36-9 |
| C_ID |
C00015824
, 
|
| InChIKey |
UCGUBQISONYIPQ-RJRFIUFINA-N |
| InChICode |
InChI=1S/C56H42O12/c57-34-11-2-28(3-12-34)1-4-32-19-40(63)25-45-48(32)52(55(66-45)30-7-15-36(59)16-8-30)44-24-42(65)27-47-51(44)53(56(68-47)31-9-17-37(60)18-10-31)43-23-41(64)26-46-50(43)49(33-20-38(61)22-39(62)21-33)54(67-46)29-5-13-35(58)14-6-29/h1-27,49,52-65H/b4-1-/t49-,52+,53+,54+,55-,56+/m0/s1 |
| SMILES |
Oc1ccc(/C=Cc2cc(O)cc3c2C(c2cc(O)cc4c2C(c2cc(O)cc5c2C(c2cc(O)cc(O)c2)C(c2ccc(O)cc2)O5)C(c2ccc(O)cc2)O4)C(c2ccc(O)cc2)O3)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Carex fedia var.miyabei | Ref. |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis amurensis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
