| Name |
Ampelopsin C |
| Formula |
C42H32O9 |
| Mw |
680.20463262 |
| CAS RN |
130518-20-6 |
| C_ID |
C00015738
, 
|
| InChIKey |
QDEHKEFWCRAFDN-RJPPMVDKNA-N |
| InChICode |
InChI=1S/C42H32O9/c43-23-7-1-19(2-8-23)33-35(22-13-26(46)15-27(47)14-22)40-34(20-3-9-24(44)10-4-20)36-29(16-28(48)17-30(36)49)37-39-32(18-31(50)38(33)41(39)40)51-42(37)21-5-11-25(45)12-6-21/h1-18,33-35,37,40,42-50H/t33-,34-,35+,37-,40+,42+/m1/s1 |
| SMILES |
Oc1ccc([C@H]2c3c(O)cc4c5c3[C@@H]([C@H](c3ccc(O)cc3)c3c(O)cc(O)cc3[C@H]5[C@H](c3ccc(O)cc3)O4)[C@@H]2c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Ampelopsis brevipedunculata var hancei  | Ref. |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis betulifolia | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
|
|
zoom in
| Organism | Vitis amurensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|