| Name |
7-Hydroxy-2,3,4,6-tetramethoxy-9.10-dihydrophenanthrene 7-O-glucoside Icariside A1 |
| Formula |
C24H30O10 |
| Mw |
478.18389718 |
| CAS RN |
108906-52-1 |
| C_ID |
C00015684
, 
|
| InChIKey |
VWJUIKAXHJNYMV-KZPSDTOLNA-N |
| InChICode |
InChI=1S/C24H30O10/c1-29-14-9-13-11(5-6-12-8-16(30-2)22(31-3)23(32-4)18(12)13)7-15(14)33-24-21(28)20(27)19(26)17(10-25)34-24/h7-9,17,19-21,24-28H,5-6,10H2,1-4H3/t17-,19+,20+,21+,24-/m1/s1 |
| SMILES |
COc1cc2c(cc1O[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O)CCc1cc(OC)c(OC)c(OC)c1-2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium grandiflorum var. thunbergianum  | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
|
|
zoom in
| Organism | Epimedium sagittatum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|