| Name |
Kaempferol 3,7,4'-triglucoside |
| Formula |
C33H40O21 |
| Mw |
772.20620834 |
| CAS RN |
108887-48-5 |
| C_ID |
C00013591
, 
|
| InChIKey |
GZKTYMIMRMNEII-BZZUQPSMNA-N |
| InChICode |
InChI=1S/C33H40O21/c34-7-15-19(38)23(42)26(45)31(51-15)48-11-3-1-10(2-4-11)29-30(54-33-28(47)25(44)21(40)17(9-36)53-33)22(41)18-13(37)5-12(6-14(18)50-29)49-32-27(46)24(43)20(39)16(8-35)52-32/h1-6,15-17,19-21,23-28,31-40,42-47H,7-9H2/t15-,16-,17-,19-,20-,21-,23+,24+,25-,26-,27-,28-,31-,32-,33+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Crambe cordifolia  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
|
|
zoom in
| Organism | Crocus sativus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|