| Name |
4',5,7,8-Tetramethoxyflavone 6-Demethoxytangeretin 6-Demethoxytangeritin Tetra-O-methylisoscutellarein 5,7,8-Trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
6601-66-7 |
| C_ID |
C00013304
, 
|
| InChIKey |
DDGJUTBQQURRGE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(22-2)10-16(23-3)18(24-4)19(17)25-14/h5-10H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(OC)cc(OC)c(OC)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus hassaku  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus sp.  | Ref. |
| - | - | Xinhui citrus | Ref. |
|
|
zoom in
| Organism | Citrus hassaku | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tatum, Phytochem.11,(1972),2283
Tatum, Phytochem.,17,(1978),447 |
|---|
|