| Name |
Dehydrodeoxybaimuxinol alpha-Agarofuran |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
5956-12-7 |
| C_ID |
C00013100
, 
|
| InChIKey |
ZLQADKTVJQXDIG-URXHZYQANA-N |
| InChICode |
InChI=1S/C15H24O/c1-11-6-5-8-14(4)9-7-12-10-15(11,14)16-13(12,2)3/h6,12H,5,7-10H2,1-4H3/t12-,14-,15+/m1/s1 |
| SMILES |
CC1=CCC[C@@]2(C)CC[C@@H]3C[C@]12OC3(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Thymelaeaceae | Aquilaria agallocha  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|