| Name |
(-)-Shizukafuranol Shizukafuranol [4aR-(4aalpha,5alpha,8abeta)]-4,4a,5,6,7,8,8a,9-Octahydro-3,5,8a-trimethylnaphtho[2,3-b]furan-5-ol |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
90332-93-7 |
| C_ID |
C00012949
, 
|
| InChIKey |
SUKDEKGXCURCRC-JCUKGLBFNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-10-9-17-12-8-14(2)5-4-6-15(3,16)13(14)7-11(10)12/h9,13,16H,4-8H2,1-3H3/t13-,14-,15-/m1/s1 |
| SMILES |
Cc1coc2c1C[C@@H]1[C@](C)(CCC[C@@]1(C)O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chloranthaceae | Chloranthus japonicus | Ref. |
| Plantae | Chloranthaceae | Chloranthus spicatus | Ref. |
|
|
zoom in
| Organism | Chloranthus spicatus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|