| Name |
(+)-Isobicyclogermacrenal |
| Formula |
C15H22O |
| Mw |
218.16706532 |
| CAS RN |
11268-36-5 |
| C_ID |
C00012431
, 
|
| InChIKey |
BLCUVJCHWZPQCX-WWOBKGCANA-N |
| InChICode |
InChI=1S/C15H22O/c1-11-5-4-6-12(10-16)9-14-13(8-7-11)15(14,2)3/h5,9-10,13-14H,4,6-8H2,1-3H3/b11-5+,12-9+/t13-,14-/m1/s1 |
| SMILES |
C/C1=CCC/C(C=O)=C[C@@H]2[C@@H](CC1)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
| Plantae | Aristolochiaceae | Aristolochia yunnanensis | Ref. |
|
|
zoom in
| Organism | Aristolochia mollissima | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., Journal of Natural Products, 64, (2001), 71 |
|---|
|